CAS 17178-10-8 appears in our catalog under these names: 2–Methoxyethyl p–Toluenesulfonate, 2-Methoxyethyl p-Toluenesulfonate, >98.0%(GC), 2-Methoxyethyl 4-methylbenzenesulfonate 97%, 2-Methoxyethyl 4-methylbenzenesulfonate, 97%, 97%, 2-Methoxyethyl 4-methylbenzenesulfonate, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 1g, 5g, 10g, 1000g, 1kg.
2-methoxyethyl 4-methylbenzenesulfonate (CAS 17178-10-8) is a chemical compound with the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. IUPAC name: 2-methoxyethyl 4-methylbenzenesulfonate. InChIKey: TZXJJSAQSRHKCZ-UHFFFAOYSA-N.
| Molecular formula | C10H14O4S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 2-methoxyethyl 4-methylbenzenesulfonate |
| InChIKey | TZXJJSAQSRHKCZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOC |
Computed by PubChem (NCBI)