Products 2375270-61-2

CAS 2375270-61-2 is the registry number for Methyl 5-{((2-methoxyethyl)sulfanyl)methyl}furan-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5-(2-methoxyethylsulfanylmethyl)furan-2-carboxylate (CAS 2375270-61-2) is a chemical compound with the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. IUPAC name: methyl 5-(2-methoxyethylsulfanylmethyl)furan-2-carboxylate. InChIKey: RAVNOEGQXXIVSU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O4S
Molecular weight230.28 g/mol
IUPAC namemethyl 5-(2-methoxyethylsulfanylmethyl)furan-2-carboxylate
InChIKeyRAVNOEGQXXIVSU-UHFFFAOYSA-N
SMILESCOCCSCC1=CC=C(O1)C(=O)OC

Computed by PubChem (NCBI)