CAS 1038356-45-4 appears in our catalog under these names: 2-(3-tert-Butyl-1,2,4-oxadiazol-5-yl)benzoic acid, 95%, 2-(3-tert-Butyl-1,2,4-oxadiazol-5-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid (CAS 1038356-45-4) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid. InChIKey: PHDHRVFFYFFTIE-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| InChIKey | PHDHRVFFYFFTIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=N1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)