CAS 103854-72-4 is the registry number for Methyl 2,5,6-trimethyl-3-oxo-2,3-dihydropyridazine-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,5,6-trimethyl-3-oxopyridazine-4-carboxylate (CAS 103854-72-4) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2,5,6-trimethyl-3-oxopyridazine-4-carboxylate. InChIKey: WLCWCLRAADQTNO-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2,5,6-trimethyl-3-oxopyridazine-4-carboxylate |
| InChIKey | WLCWCLRAADQTNO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N=C1C)C)C(=O)OC |
Computed by PubChem (NCBI)