Products 1038719-16-2
CAS 1038719-16-2 is the registry number for 1-(3-(Trifluoromethyl)phenyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid (CAS 1038719-16-2) is a chemical compound with the molecular formula C14H15F3O2 and a molecular weight of 272.26 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid. InChIKey: SPIKZYQFSGJPKL-UHFFFAOYSA-N.
| Molecular formula | C14H15F3O2 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]cyclohexane-1-carboxylic acid |
| InChIKey | SPIKZYQFSGJPKL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=CC=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)