Products 1547731-62-3

CAS 1547731-62-3 is the registry number for 2-Cyclopropyl-2-methyl-3-(4-(trifluoromethyl)phenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 1547731-62-3) is a chemical compound with the molecular formula C14H15F3O2 and a molecular weight of 272.26 g/mol. IUPAC name: 2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: BYXSUOZNXDYNHT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15F3O2
Molecular weight272.26 g/mol
IUPAC name2-cyclopropyl-2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid
InChIKeyBYXSUOZNXDYNHT-UHFFFAOYSA-N
SMILESCC(CC1=CC=C(C=C1)C(F)(F)F)(C2CC2)C(=O)O

Computed by PubChem (NCBI)