Products 916806-97-8
CAS 916806-97-8 appears in our catalog under these names: 4-(Cyclohexyl)-3-(trifluoromethyl)benzoic acid, 95%, 4-Cyclohexyl-3-trifluoromethylbenzoic acid, 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid 98%, 4-Cyclohexyl-3-(trifluoromethyl)benzoic acid, 98%, 98%, 4-CYCLOHEXYL-3-(TRIFLUOROMETHYL)BENZOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 5g, 10g, 25g, 100mg.
4-cyclohexyl-3-(trifluoromethyl)benzoic acid (CAS 916806-97-8) is a chemical compound with the molecular formula C14H15F3O2 and a molecular weight of 272.26 g/mol. IUPAC name: 4-cyclohexyl-3-(trifluoromethyl)benzoic acid. InChIKey: XIWQGDFYIINJLV-UHFFFAOYSA-N.
| Molecular formula | C14H15F3O2 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | 4-cyclohexyl-3-(trifluoromethyl)benzoic acid |
| InChIKey | XIWQGDFYIINJLV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)