CAS 161622-16-8 appears in our catalog under these names: Methyl 4-cyclopentyl-3-(trifluoromethyl)benzoate, 95%, Etrasimod Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-cyclopentyl-3-(trifluoromethyl)benzoate (CAS 161622-16-8) is a chemical compound with the molecular formula C14H15F3O2 and a molecular weight of 272.26 g/mol. IUPAC name: methyl 4-cyclopentyl-3-(trifluoromethyl)benzoate. InChIKey: RNESLRWEWHPCSY-UHFFFAOYSA-N.
| Molecular formula | C14H15F3O2 |
|---|---|
| Molecular weight | 272.26 g/mol |
| IUPAC name | methyl 4-cyclopentyl-3-(trifluoromethyl)benzoate |
| InChIKey | RNESLRWEWHPCSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C2CCCC2)C(F)(F)F |
Computed by PubChem (NCBI)