CAS 103877-02-7 appears in our catalog under these names: Omeprazole Impurity 1, 2-[(4-Methoxy-3,5-dimethyl-2-pyridyl)methylsulfanyl]-1h-benzimidazol-5-ol, 98+%, 5-O-Desmethyl Omeprazole Sulfide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1mg, 5mg.
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-ol (CAS 103877-02-7) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-ol. InChIKey: QAPIOBRWGYAHRI-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-ol |
| InChIKey | QAPIOBRWGYAHRI-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)CSC2=NC3=C(N2)C=C(C=C3)O |
Computed by PubChem (NCBI)