Products 899-59-2
CAS 899-59-2 is the registry number for 3-(3,6-Dimethyl-1H-pyrazolo[3,4-b]quinolin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,6-dimethylpyrazolo[5,4-b]quinolin-1-yl)thiolane 1,1-dioxide (CAS 899-59-2) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 3-(3,6-dimethylpyrazolo[5,4-b]quinolin-1-yl)thiolane 1,1-dioxide. InChIKey: BUKJEDOCPBXGHE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 3-(3,6-dimethylpyrazolo[5,4-b]quinolin-1-yl)thiolane 1,1-dioxide |
| InChIKey | BUKJEDOCPBXGHE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=C(N=C2C=C1)N(N=C3C)C4CCS(=O)(=O)C4 |
Computed by PubChem (NCBI)