CAS 110374-16-8 appears in our catalog under these names: 2-(((3,5-Dimethylpyridin-2-yl)methyl)sulfinyl)-5-methoxy-1h-benzo[d]imidazole, 95%, Omeprazole EP Impurity B, Omeprazole Impurity B(EP), 4-Desmethoxy Omeprazole, >95% (HPLC), 2-((RS)-((3,5-Dimethylpyridin-2-yl)methyl)sulphinyl)-5-methoxy-1H-benzimidazole. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 100mg, on request, 10mg, 50mg, 5mg, 25mg, 1mg, 0,05g.
2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole (CAS 110374-16-8) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole. InChIKey: ZMXZYNHJPJEPAE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole |
| InChIKey | ZMXZYNHJPJEPAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC)C |
Computed by PubChem (NCBI)