Products 2799695-54-6
CAS 2799695-54-6 appears in our catalog under these names: ALR2-IN-1, ALR2–IN–1, ALR2-IN-1, 99.33%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
1-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea (CAS 2799695-54-6) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 1-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea. InChIKey: YVXUMITTYYQGMP-LICLKQGHSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 1-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-3-(3-methoxyphenyl)thiourea |
| InChIKey | YVXUMITTYYQGMP-LICLKQGHSA-N |
| SMILES | CC1=CC(=C(C=C1)O)/C=N/NC(=S)NC2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)