CAS 1038915-04-6 appears in our catalog under these names: 3-(2-Bromophenyl)-1(h)-pyrazole-5-carboxylic acid, 95%, 3-(2-Bromophenyl)-1H-pyrazole-5-carboxylic acid, 98%, 3-(2-Bromophenyl)-1{H}-pyrazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g, 0,5g, 50mg.
3-(2-bromophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1038915-04-6) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 3-(2-bromophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: SRHSBISDUVBMMD-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 3-(2-bromophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | SRHSBISDUVBMMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)