CAS 2101222-51-7 is the registry number for (3R,5S)-rel-5-((1,1'-Biphenyl)-4-ylmethyl)-3-methyl-2-pyrrolidinone (Racemic Mixture), >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(3R,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one (CAS 2101222-51-7) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: (3R,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one. InChIKey: AFMGAVDATRJOJG-DYVFJYSZSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | (3R,5S)-3-methyl-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one |
| InChIKey | AFMGAVDATRJOJG-DYVFJYSZSA-N |
| SMILES | C[C@@H]1C[C@H](NC1=O)CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)