Products 103900-78-3
CAS 103900-78-3 is the registry number for Methyl 4-hydroxy-6-oxo-2-(trifluoromethyl)-1,6-dihydropyridine-3-carboxylate 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-hydroxy-6-oxo-2-(trifluoromethyl)-1H-pyridine-3-carboxylate (CAS 103900-78-3) is a chemical compound with the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. IUPAC name: methyl 4-hydroxy-6-oxo-2-(trifluoromethyl)-1H-pyridine-3-carboxylate. InChIKey: QQQMCEDMOALJGL-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | methyl 4-hydroxy-6-oxo-2-(trifluoromethyl)-1H-pyridine-3-carboxylate |
| InChIKey | QQQMCEDMOALJGL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(NC(=O)C=C1O)C(F)(F)F |
Computed by PubChem (NCBI)