Products 1803913-52-1

CAS 1803913-52-1 is the registry number for 3-Methoxy-4-(trifluoromethoxy)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylic acid (CAS 1803913-52-1) is a chemical compound with the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. IUPAC name: 3-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylic acid. InChIKey: GHOXQVWXEXWVQG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F3NO4
Molecular weight237.13 g/mol
IUPAC name3-methoxy-4-(trifluoromethoxy)pyridine-2-carboxylic acid
InChIKeyGHOXQVWXEXWVQG-UHFFFAOYSA-N
SMILESCOC1=C(C=CN=C1C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)