Products 1538710-07-4
CAS 1538710-07-4 is the registry number for 5-((Trifluoroacetamido)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[[(2,2,2-trifluoroacetyl)amino]methyl]furan-2-carboxylic acid (CAS 1538710-07-4) is a chemical compound with the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. IUPAC name: 5-[[(2,2,2-trifluoroacetyl)amino]methyl]furan-2-carboxylic acid. InChIKey: YEDRJAMIEMSKQL-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 5-[[(2,2,2-trifluoroacetyl)amino]methyl]furan-2-carboxylic acid |
| InChIKey | YEDRJAMIEMSKQL-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)