CAS 1260770-16-8 appears in our catalog under these names: 4-Methoxy-2-trifluoromethoxynitrobenzene, 95%, 4-Methoxy-1-nitro-2-(trifluoromethoxy)benzene, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
4-methoxy-1-nitro-2-(trifluoromethoxy)benzene (CAS 1260770-16-8) is a chemical compound with the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. IUPAC name: 4-methoxy-1-nitro-2-(trifluoromethoxy)benzene. InChIKey: JSIYUZKPIAIKCO-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 4-methoxy-1-nitro-2-(trifluoromethoxy)benzene |
| InChIKey | JSIYUZKPIAIKCO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)