Products 1039053-05-8

CAS 1039053-05-8 is the registry number for 3-(2,4-Difluorophenyl)-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

3-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1039053-05-8) is a chemical compound with the molecular formula C10H6F2N2O2 and a molecular weight of 224.16 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: LRDOJMOGOIKYLF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F2N2O2
Molecular weight224.16 g/mol
IUPAC name3-(2,4-difluorophenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyLRDOJMOGOIKYLF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)C2=NNC(=C2)C(=O)O

Computed by PubChem (NCBI)