Products 1152533-85-1
CAS 1152533-85-1 is the registry number for 1-(2,4-Difluorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-difluorophenyl)pyrazole-3-carboxylic acid (CAS 1152533-85-1) is a chemical compound with the molecular formula C10H6F2N2O2 and a molecular weight of 224.16 g/mol. IUPAC name: 1-(2,4-difluorophenyl)pyrazole-3-carboxylic acid. InChIKey: LEWKRIWZTYUQFH-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O2 |
|---|---|
| Molecular weight | 224.16 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | LEWKRIWZTYUQFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)