CAS 1276541-99-1 appears in our catalog under these names: 5-(3,5-Difluorophenyl)-1h-pyrazole-3-carboxylic acid, 95%, 3-(3,5-Difluorophenyl)-1H-pyrazole-5-carboxylic acid, 95%, 5-(3,5-difluorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.
3-(3,5-difluorophenyl)-1H-pyrazole-5-carboxylic acid (CAS 1276541-99-1) is a chemical compound with the molecular formula C10H6F2N2O2 and a molecular weight of 224.16 g/mol. IUPAC name: 3-(3,5-difluorophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: FXNNWDFZQWBOLL-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O2 |
|---|---|
| Molecular weight | 224.16 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | FXNNWDFZQWBOLL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)