CAS 1152534-38-7 is the registry number for 1-(3,5-Difluorophenyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3,5-difluorophenyl)pyrazole-3-carboxylic acid (CAS 1152534-38-7) is a chemical compound with the molecular formula C10H6F2N2O2 and a molecular weight of 224.16 g/mol. IUPAC name: 1-(3,5-difluorophenyl)pyrazole-3-carboxylic acid. InChIKey: KZECBNPKDMPAEC-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O2 |
|---|---|
| Molecular weight | 224.16 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | KZECBNPKDMPAEC-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1C(=O)O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)