CAS 103907-17-1 is the registry number for 5-Phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 103907-17-1) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: 5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: JVSWDRKCFPOJLM-UHFFFAOYSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | JVSWDRKCFPOJLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=NC(=NN3C=C2)N |
Computed by PubChem (NCBI)