CAS 103914-52-9 appears in our catalog under these names: 2–(4–Bromo–phenyl)quinoline–4–carboxylic acid, 2-(4-BROMO-PHENYL)-QUINOLINE-4-CARBOXYLIC ACID, 95+%, 95+%, 2-(4-Bromo-phenyl)quinoline-4-carboxylic acid, 95+%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2-(4-bromophenyl)quinoline-4-carboxylic acid (CAS 103914-52-9) is a chemical compound with the molecular formula C16H10BrNO2 and a molecular weight of 328.16 g/mol. IUPAC name: 2-(4-bromophenyl)quinoline-4-carboxylic acid. InChIKey: JEUYPXDMAWIMOG-UHFFFAOYSA-N.
| Molecular formula | C16H10BrNO2 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)quinoline-4-carboxylic acid |
| InChIKey | JEUYPXDMAWIMOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)