Products 897555-42-9

CAS 897555-42-9 is the registry number for 8-Bromo-2-phenylquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

8-bromo-2-phenylquinoline-4-carboxylic acid (CAS 897555-42-9) is a chemical compound with the molecular formula C16H10BrNO2 and a molecular weight of 328.16 g/mol. IUPAC name: 8-bromo-2-phenylquinoline-4-carboxylic acid. InChIKey: FPYDZTQBMQOCTK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10BrNO2
Molecular weight328.16 g/mol
IUPAC name8-bromo-2-phenylquinoline-4-carboxylic acid
InChIKeyFPYDZTQBMQOCTK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=C(C=CC=C3Br)C(=C2)C(=O)O

Computed by PubChem (NCBI)