CAS 501121-15-9 is the registry number for (5-(4-Bromophenyl)oxazol-2-yl)(phenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
[5-(4-bromophenyl)-1,3-oxazol-2-yl]-phenylmethanone (CAS 501121-15-9) is a chemical compound with the molecular formula C16H10BrNO2 and a molecular weight of 328.16 g/mol. IUPAC name: [5-(4-bromophenyl)-1,3-oxazol-2-yl]-phenylmethanone. InChIKey: XWAIQQZVDVNRCI-UHFFFAOYSA-N.
| Molecular formula | C16H10BrNO2 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | [5-(4-bromophenyl)-1,3-oxazol-2-yl]-phenylmethanone |
| InChIKey | XWAIQQZVDVNRCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC=C(O2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)