CAS 298230-83-8 appears in our catalog under these names: 2-(3-Bromo-phenyl)-quinoline-4-carboxylic acid, 95%, 2-(3-Bromo-phenyl)-quinoline-4-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-(3-bromophenyl)quinoline-4-carboxylic acid (CAS 298230-83-8) is a chemical compound with the molecular formula C16H10BrNO2 and a molecular weight of 328.16 g/mol. IUPAC name: 2-(3-bromophenyl)quinoline-4-carboxylic acid. InChIKey: KBIDGMKRLPPRNG-UHFFFAOYSA-N.
| Molecular formula | C16H10BrNO2 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | 2-(3-bromophenyl)quinoline-4-carboxylic acid |
| InChIKey | KBIDGMKRLPPRNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC(=CC=C3)Br)C(=O)O |
Computed by PubChem (NCBI)