Products 1039334-68-3
CAS 1039334-68-3 is the registry number for 4-(tert-Butoxy)-3-chloroaniline, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-chloro-4-[(2-methylpropan-2-yl)oxy]aniline (CAS 1039334-68-3) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 3-chloro-4-[(2-methylpropan-2-yl)oxy]aniline. InChIKey: UUXBZGOILICMAR-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 3-chloro-4-[(2-methylpropan-2-yl)oxy]aniline |
| InChIKey | UUXBZGOILICMAR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)