CAS 1039621-73-2 appears in our catalog under these names: 2,2–difluoro–2–(pyridin–2–yl)acetic acid, 2,2-difluoro-2-(pyridin-2-yl)acetic acid, 97%, 97%, Difluoro(pyridin-2-yl)acetic acid, 98%. Offered by: GLPBio, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g.
2,2-difluoro-2-pyridin-2-ylacetic acid (CAS 1039621-73-2) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2,2-difluoro-2-pyridin-2-ylacetic acid. InChIKey: YSLRWDAJQZZLAQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2,2-difluoro-2-pyridin-2-ylacetic acid |
| InChIKey | YSLRWDAJQZZLAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)