CAS 103963-45-7 is the registry number for 5,7-Dimethoxy-4'-hydroxyflavan. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2S)-5,7-dimethoxy-3,4-dihydro-2H-chromen-2-yl]phenol (CAS 103963-45-7) is a chemical compound with the molecular formula C17H18O4 and a molecular weight of 286.32 g/mol. IUPAC name: 4-[(2S)-5,7-dimethoxy-3,4-dihydro-2H-chromen-2-yl]phenol. InChIKey: AVMGPGZQJKDABF-HNNXBMFYSA-N.
| Molecular formula | C17H18O4 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | 4-[(2S)-5,7-dimethoxy-3,4-dihydro-2H-chromen-2-yl]phenol |
| InChIKey | AVMGPGZQJKDABF-HNNXBMFYSA-N |
| SMILES | COC1=CC2=C(CC[C@H](O2)C3=CC=C(C=C3)O)C(=C1)OC |
Computed by PubChem (NCBI)