CAS 103966-02-5 is the registry number for (4-methylphenyl)-N-(4-(4-methylphenyl)(2,5-thiazolyl))formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide (CAS 103966-02-5) is a chemical compound with the molecular formula C18H16N2OS and a molecular weight of 308.4 g/mol. IUPAC name: 4-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide. InChIKey: YMUIWYBAUJKUEL-UHFFFAOYSA-N.
| Molecular formula | C18H16N2OS |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 4-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzamide |
| InChIKey | YMUIWYBAUJKUEL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)