CAS 1061741-26-1 appears in our catalog under these names: 1-([1,1'-BIPHENYL]-4-YL)-3-(FURAN-2-YLMETHYL)THIOUREA, 98%, 98%, 1-(Biphenyl-4-yl)-3-(furan-2-ylmethyl)thiourea, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 500mg.
1-(furan-2-ylmethyl)-3-(4-phenylphenyl)thiourea (CAS 1061741-26-1) is a chemical compound with the molecular formula C18H16N2OS and a molecular weight of 308.4 g/mol. IUPAC name: 1-(furan-2-ylmethyl)-3-(4-phenylphenyl)thiourea. InChIKey: HZOJBBKDKOPWII-UHFFFAOYSA-N.
| Molecular formula | C18H16N2OS |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 1-(furan-2-ylmethyl)-3-(4-phenylphenyl)thiourea |
| InChIKey | HZOJBBKDKOPWII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=S)NCC3=CC=CO3 |
Computed by PubChem (NCBI)