CAS 1428139-58-5 is the registry number for 6-(5-Methyl-2-thienyl)-2-phenyl-1,5,6,7-tetrahydro-4h-benzimidazol-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(5-methylthiophen-2-yl)-2-phenyl-1,5,6,7-tetrahydrobenzimidazol-4-one (CAS 1428139-58-5) is a chemical compound with the molecular formula C18H16N2OS and a molecular weight of 308.4 g/mol. IUPAC name: 6-(5-methylthiophen-2-yl)-2-phenyl-1,5,6,7-tetrahydrobenzimidazol-4-one. InChIKey: ICACIVZLNVNKAK-UHFFFAOYSA-N.
| Molecular formula | C18H16N2OS |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 6-(5-methylthiophen-2-yl)-2-phenyl-1,5,6,7-tetrahydrobenzimidazol-4-one |
| InChIKey | ICACIVZLNVNKAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2CC3=C(C(=O)C2)N=C(N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)