CAS 588692-46-0 appears in our catalog under these names: 2-Amino-n-benzyl-4-phenylthiophene-3-carboxamide, 95%, 2-Amino-N-benzyl-4-phenylthiophene-3-carboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-amino-N-benzyl-4-phenylthiophene-3-carboxamide (CAS 588692-46-0) is a chemical compound with the molecular formula C18H16N2OS and a molecular weight of 308.4 g/mol. IUPAC name: 2-amino-N-benzyl-4-phenylthiophene-3-carboxamide. InChIKey: FBWJVQLXYDKYGK-UHFFFAOYSA-N.
| Molecular formula | C18H16N2OS |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2-amino-N-benzyl-4-phenylthiophene-3-carboxamide |
| InChIKey | FBWJVQLXYDKYGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=C(SC=C2C3=CC=CC=C3)N |
Computed by PubChem (NCBI)