CAS 103986-07-8 appears in our catalog under these names: 2,3-Dimethyl-1h-indole-7-carboxylic acid, 95%, 2,3-Dimethyl-1H-indole-7-carboxylic acid, 2,3-Dimethyl-1H-indole-7-carboxylic acid, 97%, 97%, 2,3-dimethyl-1H-indole-7-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 0,5g, 100mg, 250mg, 500mg, 2.5g, 10g.
2,3-dimethyl-1H-indole-7-carboxylic acid (CAS 103986-07-8) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2,3-dimethyl-1H-indole-7-carboxylic acid. InChIKey: ITMIUTVFOTYMOJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2,3-dimethyl-1H-indole-7-carboxylic acid |
| InChIKey | ITMIUTVFOTYMOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)