Products 1039863-24-5

CAS 1039863-24-5 is the registry number for 5-((3,5-Dimethylphenyl)amino)pentanoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

5-(3,5-dimethylanilino)pentanoic acid (CAS 1039863-24-5) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 5-(3,5-dimethylanilino)pentanoic acid. InChIKey: PQCNXFYCJCAFJS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO2
Molecular weight221.29 g/mol
IUPAC name5-(3,5-dimethylanilino)pentanoic acid
InChIKeyPQCNXFYCJCAFJS-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)NCCCCC(=O)O)C

Computed by PubChem (NCBI)