CAS 1039994-46-1 is the registry number for 1-(3-Isobutyl-1,2,4-oxadiazol-5-yl)ethanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1039994-46-1) is a chemical compound with the molecular formula C8H16ClN3O and a molecular weight of 205.68 g/mol. IUPAC name: 1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: WEUCDSZRZWCHOX-UHFFFAOYSA-N.
| Molecular formula | C8H16ClN3O |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | WEUCDSZRZWCHOX-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NOC(=N1)C(C)N.Cl |
Computed by PubChem (NCBI)