Products 1221725-72-9
CAS 1221725-72-9 appears in our catalog under these names: 2-(5-Propyl-1,2,4-oxadiazol-3-yl)propan-2-amine hydrochloride, 95%, 2-(5-Propyl-1,2,4-oxadiazol-3-yl)propan-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(5-propyl-1,2,4-oxadiazol-3-yl)propan-2-amine;hydrochloride (CAS 1221725-72-9) is a chemical compound with the molecular formula C8H16ClN3O and a molecular weight of 205.68 g/mol. IUPAC name: 2-(5-propyl-1,2,4-oxadiazol-3-yl)propan-2-amine;hydrochloride. InChIKey: ZXAJXYOPGIPAHF-UHFFFAOYSA-N.
| Molecular formula | C8H16ClN3O |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-(5-propyl-1,2,4-oxadiazol-3-yl)propan-2-amine;hydrochloride |
| InChIKey | ZXAJXYOPGIPAHF-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=NO1)C(C)(C)N.Cl |
Computed by PubChem (NCBI)