CAS 1244059-96-8 appears in our catalog under these names: 2-(5-(tert-Butyl)-1,2,4-oxadiazol-3-yl)ethan-1-amine hydrochloride, 95%, 2-(5-tert-Butyl-1,2,4-oxadiazol-3-yl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethanamine;hydrochloride (CAS 1244059-96-8) is a chemical compound with the molecular formula C8H16ClN3O and a molecular weight of 205.68 g/mol. IUPAC name: 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethanamine;hydrochloride. InChIKey: SRBWVDKPYWDGQU-UHFFFAOYSA-N.
| Molecular formula | C8H16ClN3O |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethanamine;hydrochloride |
| InChIKey | SRBWVDKPYWDGQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NO1)CCN.Cl |
Computed by PubChem (NCBI)