CAS 1359821-87-6 is the registry number for [(1S)-1-(3-Isobutyl-1,2,4-oxadiazol-5-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1S)-1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1359821-87-6) is a chemical compound with the molecular formula C8H16ClN3O and a molecular weight of 205.68 g/mol. IUPAC name: (1S)-1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: WEUCDSZRZWCHOX-RGMNGODLSA-N.
| Molecular formula | C8H16ClN3O |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | (1S)-1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | WEUCDSZRZWCHOX-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=NC(=NO1)CC(C)C)N.Cl |
Computed by PubChem (NCBI)