Products 104007-06-9

CAS 104007-06-9 is the registry number for 1,3-Diethyl 2-{((2,4-dimethylphenyl)amino)methylidene}propanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[(2,4-dimethylanilino)methylidene]propanedioate (CAS 104007-06-9) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: diethyl 2-[(2,4-dimethylanilino)methylidene]propanedioate. InChIKey: MXFZEZXAMXAJSR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC namediethyl 2-[(2,4-dimethylanilino)methylidene]propanedioate
InChIKeyMXFZEZXAMXAJSR-UHFFFAOYSA-N
SMILESCCOC(=O)C(=CNC1=C(C=C(C=C1)C)C)C(=O)OCC

Computed by PubChem (NCBI)