Products 1040077-27-7

CAS 1040077-27-7 is the registry number for 3-(4-Bromo-2-fluoro-phenoxymethyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(4-bromo-2-fluorophenoxy)methyl]benzoic acid (CAS 1040077-27-7) is a chemical compound with the molecular formula C14H10BrFO3 and a molecular weight of 325.13 g/mol. IUPAC name: 3-[(4-bromo-2-fluorophenoxy)methyl]benzoic acid. InChIKey: QJLJWPCVXYXJJR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10BrFO3
Molecular weight325.13 g/mol
IUPAC name3-[(4-bromo-2-fluorophenoxy)methyl]benzoic acid
InChIKeyQJLJWPCVXYXJJR-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)COC2=C(C=C(C=C2)Br)F

Computed by PubChem (NCBI)