CAS 1875441-58-9 is the registry number for 4-(Benzyloxy)-2-bromo-5-fluorobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-fluoro-4-phenylmethoxybenzoic acid (CAS 1875441-58-9) is a chemical compound with the molecular formula C14H10BrFO3 and a molecular weight of 325.13 g/mol. IUPAC name: 2-bromo-5-fluoro-4-phenylmethoxybenzoic acid. InChIKey: DOSPVBFOTMHCQH-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO3 |
|---|---|
| Molecular weight | 325.13 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-phenylmethoxybenzoic acid |
| InChIKey | DOSPVBFOTMHCQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)Br)C(=O)O)F |
Computed by PubChem (NCBI)