Products 1823581-55-0
CAS 1823581-55-0 is the registry number for 3-(benzyloxy)-4-bromo-2-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-bromo-2-fluoro-3-phenylmethoxybenzoic acid (CAS 1823581-55-0) is a chemical compound with the molecular formula C14H10BrFO3 and a molecular weight of 325.13 g/mol. IUPAC name: 4-bromo-2-fluoro-3-phenylmethoxybenzoic acid. InChIKey: PCVTXRQCUMOBQZ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO3 |
|---|---|
| Molecular weight | 325.13 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-phenylmethoxybenzoic acid |
| InChIKey | PCVTXRQCUMOBQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)C(=O)O)Br |
Computed by PubChem (NCBI)