CAS 743467-23-4 appears in our catalog under these names: 3-(Benzyloxy)-6-bromo-2-fluorobenzoic acid, 95%, 3-(Benzyloxy)-6-bromo-2-fluorobenzoic acid, 98%, 3-(Benzyloxy)-6-bromo-2-fluorobenzoic acid, ≥95%, ≥95%, 3-(Benzyloxy)-6-bromo-2-fluorobenzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
6-bromo-2-fluoro-3-phenylmethoxybenzoic acid (CAS 743467-23-4) is a chemical compound with the molecular formula C14H10BrFO3 and a molecular weight of 325.13 g/mol. IUPAC name: 6-bromo-2-fluoro-3-phenylmethoxybenzoic acid. InChIKey: LWBFGBUGEGNQOD-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO3 |
|---|---|
| Molecular weight | 325.13 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-phenylmethoxybenzoic acid |
| InChIKey | LWBFGBUGEGNQOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)C(=O)O)F |
Computed by PubChem (NCBI)