CAS 104022-80-2 is the registry number for Moniliphenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoate (CAS 104022-80-2) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoate. InChIKey: OLWGLSCBBRIVGJ-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | methyl 2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoate |
| InChIKey | OLWGLSCBBRIVGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)C(=O)C2=C(C=CC=C2O)C(=O)OC)O |
Computed by PubChem (NCBI)