Products 10408-86-3
CAS 10408-86-3 appears in our catalog under these names: 6,7,8,9-Tetrahydro-5h-benzo[7]annulen-5-amine hydrochloride, 95%, 6,7,8,9-Tetrahydro-5H-benzo(7)annulen-5-amine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylazanium chloride (CAS 10408-86-3) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylazanium chloride. InChIKey: ADJNJLPAJFJRCW-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ylazanium chloride |
| InChIKey | ADJNJLPAJFJRCW-UHFFFAOYSA-N |
| SMILES | C1CCC2=CC=CC=C2C(C1)[NH3+].[Cl-] |
Computed by PubChem (NCBI)