CAS 104113-71-5 appears in our catalog under these names: 1-(Naphth-1-yl)piperazine dihydrochloride, 96%, 1-(1-Naphthyl)piperazinemiddotHCl, 1-(1-Naphthyl)piperazine hydrochloride, 96%, 1-(1-Naphthyl) piperazine hydrochloride/ 98.8% (existing batch purity), 1–(1–Naphthyl) piperazine (hydrochloride). Offered by: Combi-blocks, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: 1g, 250mg, 500mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-naphthalen-1-ylpiperazine;hydrochloride (CAS 104113-71-5) is a chemical compound with the molecular formula C14H17ClN2 and a molecular weight of 248.75 g/mol. IUPAC name: 1-naphthalen-1-ylpiperazine;hydrochloride. InChIKey: ZYVYPNZFOCZLEM-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | 1-naphthalen-1-ylpiperazine;hydrochloride |
| InChIKey | ZYVYPNZFOCZLEM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)