CAS 1432679-41-8 appears in our catalog under these names: 6-Chloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine, 95%, 6-Chloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-chloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (CAS 1432679-41-8) is a chemical compound with the molecular formula C14H17ClN2 and a molecular weight of 248.75 g/mol. IUPAC name: 6-chloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine. InChIKey: VAERTUSTBUVEJY-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | 6-chloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| InChIKey | VAERTUSTBUVEJY-UHFFFAOYSA-N |
| SMILES | CCNC1CCC2=C(C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)