CAS 1803591-56-1 is the registry number for 4-(3-Aminophenyl)-N,N-dimethylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[4-(dimethylamino)phenyl]aniline;hydrochloride (CAS 1803591-56-1) is a chemical compound with the molecular formula C14H17ClN2 and a molecular weight of 248.75 g/mol. IUPAC name: 3-[4-(dimethylamino)phenyl]aniline;hydrochloride. InChIKey: FBOZJKDKJSGNCI-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | 3-[4-(dimethylamino)phenyl]aniline;hydrochloride |
| InChIKey | FBOZJKDKJSGNCI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)